5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphyrin iron(III) chloride
ALDRICH/252913 - ≥95% (HPLC)
CAS Number: 36965-71-6
Empirical Formula (Hill Notation): C44H8ClF20FeN4
Molecular Weight: 1063.83
MDL Number: MFCD00012151
Linear Formula: C44H8ClF20FeN4
Product Type: Chemical
| λmax | 415 nm |
| 498 nm (2nd) | |
| assay | ≥95% (HPLC) |
| form | powder |
| InChI | 1S/C44H8F20N4.ClH.Fe/c45- |
| InChI key | RVNJZXLLVARDGN-VTVSBRCESA |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: catalyst core: iron |
| SMILES string | Fc1c(F)c(F)c(c(F)c1F)-c2c |
| Application: | Catalyst for epoxidations with peroxides, oxidative decarbonylations, and aliphatic hydroxylations. |
| Features and Benefits: | Catalyst for epoxidations with peroxides, oxidative decarbonylations, and aliphatic hydroxylations. |
| Features and Benefits: | Preferred catalyst in catalytic oxygenation reactions. |
| Packaging: | 100 mg in glass insert |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥95% (HPLC) |
| UNSPSC | 12352103 |


