Diphenylphosphine
ALDRICH/252964 - 98%
Synonym: HPPh2; Ph2PH
CAS Number: 829-85-6
Empirical Formula (Hill Notation): C12H11P
Molecular Weight: 186.19
EC Number: 212-591-4
MDL Number: MFCD00003040
Linear Formula: (C6H5)2PH
Product Type: Chemical
assay | 98% |
bp | 280 °C (lit.) |
density | 1.07 g/mL at 25 °C (lit.) |
form | liquid |
functional group | phosphine |
InChI | 1S/C12H11P/c1-3-7-11(8-4- |
InChI key | GPAYUJZHTULNBE-UHFFFAOYSA |
Quality Level | 200 |
reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
reaction type: Heck Reaction | |
reaction type: Hiyama Coupling | |
reaction type: Negishi Coupling | |
reaction type: Sonogashira Coupling | |
reaction type: Stille Coupling | |
reaction type: Suzuki-Miyaura Coupling | |
reagent type: ligand | |
refractive index | n |
SMILES string | C1(PC2=CC=CC=C2)=CC=CC=C1 |
vapor pressure | 2 mmHg ( 110 °C) |
Application: | Deprotonation of Ph2PH gives diphenylphosphide, used for synthesis of novel phosphine ligands, Wittig-Horner reagents, and phosphonium salts; source of phosphorus-centered radicals. |
Packaging: | 1 kg in Sure/Seal™ |
Packaging: | 10 g in glass bottle |
Packaging: | 50 g in Sure/Seal™ |
Symbol | GHS02,GHS07 |
Signal word | Danger |
Hazard statements | H250 - H315 - H319 - H335 |
Precautionary statements | P210 - P222 - P231 + P232 - P233 - P302 + P352 - P305 + P351 + P338 |
Hazard Codes | F,Xi |
Risk Statements | 17-36/37/38 |
Safety Statements | 26-36 |
RIDADR | UN 2845 4.2 |
WGK Germany | WGK 3 |
Flash Point(F) | 230.0 °F - closed cup |
Flash Point(C) | 110 °C - closed cup |
Purity | 98% |
bp | 280 °C (lit.) |
Density | 1.07 g/mL at 25 °C (lit.) |
Refractive Index | n |
UNSPSC | 12352002 |