Synonym: 1,3-Bis(1,1-dimethylethyl) propanedioate; 1,3-Di-tert-butyl propanedioate; Bis(1,1-dimethylethyl) malonate; di-tert-butyl propanedioate; tert-Butyl malonate
CAS Number: 541-16-2
Empirical Formula (Hill Notation): C11H20O4
Molecular Weight: 216.27
EC Number: 208-769-6
MDL Number: MFCD00008810
Linear Formula: (CH3)3COCOCH2COOC(CH3)3
Product Type: Chemical
| assay |
98% |
| bp |
110-111 °C/22 mmHg (lit.) |
| density |
0.966 g/mL at 25 °C (lit.) |
| form |
liquid |
| InChI |
1S/C11H20O4/c1-10(2,3)14-8(12)7-9(13)15-11(4,5)6/h7H2,1-6H3 |
| InChI key |
CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| mp |
−7-−6 °C (lit.) |
| Quality Level |
200  |
| refractive index |
n20/D 1.418 (lit.) |
| SMILES string |
CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Application: |
Di-tert-butyl malonate was used in total synthesis of (+/−)-actinophyllic acid. It was also employed as precursor for metal-organic chemical vapor deposition of HfO2 and ZrO2 thin films. |
| Packaging: |
10 g in glass bottle |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
192.2 °F - closed cup |
| Flash Point(C) |
89 °C - closed cup |
| Purity |
98% |
| bp |
110-111 °C/22 mmHg (lit.) |
| mp |
−7-−6 °C (lit.) |
| Density |
0.966 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.418 (lit.) |
| UNSPSC |
12352100 |
