(−)-Methyl (S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
ALDRICH/254606 - 96%
Synonym: α,β-Isopropylidene-L-glyceric acid methyl ester; Methyl α,β-isopropylidene-L-glycerate; Methyl 2,3-O-isopropylidene-L-glycerate
CAS Number: 60456-21-5
Empirical Formula (Hill Notation): C7H12O4
Molecular Weight: 160.17
MDL Number: MFCD00066526
Linear Formula: C7H12O4
Product Type: Chemical
| assay | 96% |
| bp | 84-86 °C/15 mmHg (lit.) |
| density | 1.106 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ester |
| ether | |
| ketal | |
| InChI | 1S/C7H12O4/c1-7(2)10-4-5( |
| InChI key | DOWWCCDWPKGNGX-YFKPBYRVSA |
| optical activity | [α]20/D −8.5°, c = 1.5 in acetone |
| optical purity | ee: ≥96.0% (GLC) |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | COC(=O)[C@@H]1COC(C)(C)O1 |
| Application: | (−)-Methyl (S)-2,2-dimethyl-1,3-dioxol • As a chiral building block to make the key tetrahydrofuran subunit of (−)-gymnodimine, a marine algal toxin. • To prepare an enedione by reacting with dimethyl methylphosphonate, BuLi, and phenylglyoxal, which in turn is used to synthesize cyclopentenone derivatives. • As a starting material for the preparation of (S)-4,5-dihydroxy-2,3-penta |
| Packaging: | 5 g in glass bottle |
| WGK Germany | WGK 3 |
| Flash Point(F) | 172.4 °F - closed cup |
| Flash Point(C) | 78 °C - closed cup |
| Purity | 96% |
| bp | 84-86 °C/15 mmHg (lit.) |
| Density | 1.106 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352005 |

