(S,S)-(−)-Hydrobenzoin
ALDRICH/256269 - 99%, optical purity ee: 99% (GLC)
Synonym: (S,S)-(−)-1,2-Diphenyl-1,2-ethanediol; (S,S)
CAS Number: 2325-10-2
Empirical Formula (Hill Notation): C14H14O2
Molecular Weight: 214.26
MDL Number: MFCD00064255
Linear Formula: C6H5CH(OH)CH(OH)C6H5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 256269-25G
| assay | 99% |
| functional group | hydroxyl |
| phenyl | |
| InChI | 1S/C14H14O2/c15-13(11-7-3 |
| InChI key | IHPDTPWNFBQHEB-KBPBESRZSA |
| mp | 148-150 °C (lit.) |
| optical activity | [α]24/D −94°, c = 2.5 in ethanol |
| optical purity | ee: 99% (GLC) |
| Quality Level | 200  |
| SMILES string | O[C@H]([C@@H](O)c1ccccc1) |
| Application: | (S,S)-(-)-Hydrobenzoin may also be used to prepare (1S,2S,1′S)- and (1S,2S,1′R)-2-(cyclohex-2′-enyloxy)-1,2-diphenylethanol, which are intermediates to prepare enantiopure cyclohexitols. The (S,S)-(-)-hydrobenzoin/Ca complex may be used to catalyze the direct asymmetric aldol reaction of acetophenone and pivalaldehyde to form (R)-3-hydroxy-4,4-dimethyl- |
| Application: | C2 symmetric chiral diol with versatile applications as a chiral auxiliary, building block, and chiral ligand. |
| General description: | Chiral reagent. |
| Packaging: | 5, 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 148-150 °C (lit.) |
| UNSPSC | 12352002 |