Synonym: 1,1,2,2,3,3,4,4-Octafluoropentan-5-ol; 1,1,5-Trihydro-1-hydroxyperfluoropentane; 1,1,5-Trihydrooctafluoropentan-1-ol; 1,1,5-Trihydrooctafluoropentyl alcohol; 1,1,5-Trihydroperfluoropentan-1-ol
CAS Number: 355-80-6
Empirical Formula (Hill Notation): C5H4F8O
Molecular Weight: 232.07
EC Number: 206-593-4
MDL Number: MFCD00039631
Linear Formula: F2CH(CF2)3CH2OH
Product Type: Chemical
| assay |
98% |
| bp |
141-142 °C (lit.) |
| density |
1.667 g/mL at 25 °C (lit.) |
| functional group |
fluoro |
| |
hydroxyl |
| InChI |
1S/C5H4F8O/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h2,14H,1H2 |
| InChI key |
JUGSKHLZINSXPQ-UHFFFAOYSA-N |
| Quality Level |
100  |
| refractive index |
n20/D 1.318 (lit.) |
| SMILES string |
OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Application: |
2,2,3,3,4,4,5,5-Octafluoro-1-pentanol was used as a cosurfactant in the synthesis of silver and silver iodide nanocrystals. It was also used in the synthesis of Ag2S nanocrystals with a characteristic surface plasmon resonance absorption at 330nm. |
| Packaging: |
100 g in poly bottle |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-37/39 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
168.8 °F - closed cup |
| Flash Point(C) |
76 °C - closed cup |
| Purity |
98% |
| bp |
141-142 °C (lit.) |
| Density |
1.667 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.318 (lit.) |
| UNSPSC |
12352100 |
