Synonym: 1,3-Bis(1,1-dimethylethyl)benzene; 1,3-Ditert-butylbenzene; 4,6-Di(tert-butyl)benzene; m-Di-tert-butylbenzene
CAS Number: 1014-60-4
Empirical Formula (Hill Notation): C14H22
Molecular Weight: 190.32
MDL Number: MFCD00008830
Linear Formula: C6H4[C(CH3)3]2
Product Type: Chemical
| assay |
97% |
| bp |
106-107 °C/18 mmHg (lit.) |
| density |
0.859 g/mL at 25 °C (lit.) |
| form |
liquid |
| InChI |
1S/C14H22/c1-13(2,3)11-8-7-9-12(10-11)14(4,5)6/h7-10H,1-6H3 |
| InChI key |
ILNDSSCEZZFNGE-UHFFFAOYSA-N |
| mp |
10-11 °C (lit.) |
| Quality Level |
100  |
| refractive index |
n20/D 1.488 (lit.) |
| SMILES string |
CC(C)(C)c1cccc(c1)C(C)(C)C |
| General description: |
The solute-solvent nuclear overhauser effects (NOEs) of 1,3-di-tert-butylbenzene was studied in solvents composed of tetramethylsilane, perfluoro-tert-butyl alcohol and carbon tetrachloride. |
| Packaging: |
1 g in glass bottle |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
183.2 °F - closed cup |
| Flash Point(C) |
84 °C - closed cup |
| Purity |
97% |
| bp |
106-107 °C/18 mmHg (lit.) |
| mp |
10-11 °C (lit.) |
| Density |
0.859 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.488 (lit.) |
| UNSPSC |
12352100 |
