3,5-Di-tert-butyltoluene
ALDRICH/273015 - 95%
CAS Number: 15181-11-0
Empirical Formula (Hill Notation): C15H24
Molecular Weight: 204.35
EC Number: 239-230-3
MDL Number: MFCD00026300
Linear Formula: CH3C6H3[C(CH3)3]2
Product Type: Chemical
| assay | 95% |
| bp | 244 °C (lit.) |
| density | 0.86 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C15H24/c1-11-8-12(14(2 |
| InChI key | WIXDSJRJFDWTNY-UHFFFAOYSA |
| mp | 31-32 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | Cc1cc(cc(c1)C(C)(C)C)C(C) |
| Application: | 3,5-Di-tert-butyltoluene was used in the synthesis of 3,5-di-tert-butyl(bromomethyl)benzene. It was also used in the synthesis of di-tert-butylbenzoic acid. |
| Packaging: | 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| bp | 244 °C (lit.) |
| mp | 31-32 °C (lit.) |
| Density | 0.86 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |