Methyl P,P-bis(2,2,2-trifluoroethyl)phosphonoacetate
ALDRICH/274259 - 95%
Synonym: Bis(2,2,2-
CAS Number: 88738-78-7
Empirical Formula (Hill Notation): C7H9F6O5P
Molecular Weight: 318.11
MDL Number: MFCD00009901
Linear Formula: CH3O2CCH2P(O)(OCH2CF3)2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 274259-5G.
| assay | 95% |
| density | 1.504 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ester |
| fluoro | |
| phosphonate | |
| InChI | 1S/C7H9F6O5P/c1-16-5(14)2 |
| InChI key | PVSJXEDBEXYLML-UHFFFAOYSA |
| Quality Level | 200  |
| reaction suitability | reaction type: C-C Bond Formation |
| refractive index | n |
| SMILES string | COC(=O)CP(=O)(OCC(F)(F)F) |
| Application: | Methyl P,P-bis(2,2,2-trifluoroethyl • In one of the key synthetic steps for the preparation of trans-hydrindanes and (R)-(+)-umbelactone. • To prepare a cis-olefinic ester derivative by Still–Gennari olefination of an aldehyde derivative using 18-crown ether and potassium bis(trimethylsilyl)amide (KHMDS). • In the synthesis of (−)-(6S,2′S)-epi cryptocaryalactone. |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | 95% |
| Density | 1.504 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352108 |