2,5-Di-tert-butylaniline
ALDRICH/275735 - 99%
CAS Number: 21860-03-7
Empirical Formula (Hill Notation): C14H23N
Molecular Weight: 205.34
MDL Number: MFCD00010338
Linear Formula: [(CH3)3C]2C6H3NH2
Product Type: Chemical
| assay | 99% |
| form | powder |
| InChI | 1S/C14H23N/c1-13(2,3)10-7 |
| InChI key | NUZVLYNISQOZOW-UHFFFAOYSA |
| mp | 103-106 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | CC(C)(C)c1ccc(c(N)c1)C(C) |
| Application: | 2,5-Di-tert-butylaniline has been used in the preparation of: • new rigid bidentate nitrogen ligands 1,2-bis[(2,5-di-tert-butylphenyl)imino]acenap • N-(2,5-di-tert-butylphenyl)perylene-3,4 |
| Packaging: | 10, 50 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 103-106 °C (lit.) |
| UNSPSC | 12352100 |


