5,10,15,20-Tetrakis(4-methoxyphenyl)-21H,23H-porphine cobalt(II)
ALDRICH/275867
CAS Number: 28903-71-1
Empirical Formula (Hill Notation): C48H36CoN4O4
Molecular Weight: 791.76
MDL Number: MFCD00010724
Linear Formula: C48H36CoN4O4
Product Type: Chemical
| λmax | 417 nm |
| 530 nm (2nd) | |
| form | solid |
| InChI | 1S/C48H36N4O4.Co/c1-53-33 |
| InChI key | QBCIMRXPMLWVML-NHZJRHMYSA |
| Quality Level | 200 ![]() |
| reaction suitability | reagent type: catalyst core: cobalt |
| SMILES string | COc1ccc(cc1)-c2c3ccc(n3)c |
| Application: | Starting material in the synthesis of cobalt nitrosyl porphyrins for use in the study of the binding and activation of nitric oxide. |
| Features and Benefits: | Acts as a versatile catalyst during the oxidation of a wide range of organic substrates with dioxygen in the presence of 2-methylpropanal under ambient conditions. |
| Packaging: | 1, 10 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352103 |

