4-Methoxybenzenediazonium tetrafluoroborate
ALDRICH/283088 - 98%
Synonym: 4-
CAS Number: 459-64-3
Empirical Formula (Hill Notation): C7H7BF4N2O
Molecular Weight: 221.95
EC Number: 207-296-2
MDL Number: MFCD00011897
Linear Formula: CH3OC6H4N2BF4
Product Type: Chemical
| assay | 98% |
| form | solid |
| InChI | 1S/C7H7N2O.BF4/c1-10-7-4- |
| InChI key | BYGWNWAFXUPZHI-UHFFFAOYSA |
| mp | 142-144 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | F[B-](F)(F)F.COc1ccc(cc1) |
| storage temp. | −20°C |
| Application: | 4-Methoxybenzenediazonium tetrafluoroborate has been used in the preparation of azo coupled cyclic β-enaminones. |
| General description: | Interaction of 4-methoxybenzenediazonium tetrafluoroborate with synthetic DOPA-melanin and its precursors has been studied using EPR spectroscopy and spin-trapping technique. |
| Packaging: | 5 g in amber poly bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 142-144 °C (lit.) |
| Storage Temp. | −20°C |
| UNSPSC | 12352100 |


