Decanoic anhydride
ALDRICH/284688 - 96%
Synonym: Capric anhydride
CAS Number: 2082-76-0
Empirical Formula (Hill Notation): C20H38O3
Molecular Weight: 326.51
EC Number: 218-213-4
MDL Number: MFCD00010460
Linear Formula: [CH3(CH2)8CO]2O
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 284688-10G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 284688-1G
| assay | 96% |
| bp | 125-140 °C/0.05 mmHg (lit.) |
| density | 0.886 g/mL at 25 °C (lit.) |
| form | solid |
| functional group | anhydride |
| ester | |
| InChI | 1S/C20H38O3/c1-3-5-7-9-11 |
| InChI key | HTWWKYKIBSHDPC-UHFFFAOYSA |
| mp | 24-25 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CCCCCCCCCC(=O)OC(=O)CCCCC |
| solubility | chloroform: soluble 100 mg/mL, clear, colorless to light yellow |
| Application: | Decanoic anhydride was used in the synthesis of 2-deoxy-2-p-methoxybenzylimideneamin |
| Packaging: | 1, 10 g in glass bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | 96% |
| bp | 125-140 °C/0.05 mmHg (lit.) |
| mp | 24-25 °C (lit.) |
| Density | 0.886 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |