Synonym: 11-Ketoandrostenedione; 4-Androstene-3,11,17-trione; Androst-4-ene-3,11,17-trione; Reichstein’s substance G
CAS Number: 382-45-6
Empirical Formula (Hill Notation): C19H24O3
Molecular Weight: 300.39
EC Number: 206-843-2
MDL Number: MFCD00003606
Linear Formula: C19H24O3
Product Type: Chemical
| assay |
98% |
| functional group |
ketone |
| InChI |
1S/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-14,17H,3-8,10H2,1-2H3/t13-,14-,17+,18-,19-/m0/s1 |
| InChI key |
RZRPTBIGEANTGU-IRIMSJTPSA-N |
| mp |
219-222 °C (lit.) |
| optical activity |
[α]20/D +300°, c = 1 in chloroform |
| Quality Level |
100  |
| SMILES string |
C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CCC2=O |
| Application: |
Adrenosterone has been used to study its effect on cell morphology, cell number and myogenic differentiation in killifish cell line, KFE-5. |
| General description: |
Adrenosterone is a steroid hormone that is used as a dietary supplement to decrease fat and increase muscle mass. |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
98% |
| mp |
219-222 °C (lit.) |
| UNSPSC |
12352115 |
