Synonym: (−)-2-Hydroxyisopinocampheol; [1R-(1α,2α,3α,5α)]-2,6,6-Trimethylbicyclo[3.1.1]heptane-2,3-diol
CAS Number: 22422-34-0
Empirical Formula (Hill Notation): C10H18O2
Molecular Weight: 170.25
MDL Number: MFCD09955216
Linear Formula: C10H18O2
Product Type: Chemical
| assay |
99% |
| bp |
101-102 °C/1 mmHg (lit.) |
| functional group |
hydroxyl |
| InChI |
1S/C10H18O2/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-8,11-12H,4-5H2,1-3H3/t6-,7-,8+,10-/m1/s1 |
| InChI key |
MOILFCKRQFQVFS-BDNRQGISSA-N |
| mp |
57-59 °C (lit.) |
| optical activity |
[α]21/D −8.6°, c = 6.5 in toluene |
| optical purity |
ee: 97% (GLC) |
| Quality Level |
200  |
| SMILES string |
CC1(C)[C@H]2C[C@H](O)[C@](C)(O)[C@@H]1C2 |
| Application: |
Used to prepare chiral double allylation reagents. |
| Packaging: |
1, 5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
230.0 °F - closed cup |
| Flash Point(C) |
110 °C - closed cup |
| Purity |
99% |
| bp |
101-102 °C/1 mmHg (lit.) |
| mp |
57-59 °C (lit.) |
| UNSPSC |
12352001 |