o-Carborane
ALDRICH/288187 - 98%
Synonym: 1,2-
CAS Number: 16872-09-6
Empirical Formula (Hill Notation): C2H12B10
Molecular Weight: 144.23
EC Number: 240-897-8
MDL Number: MFCD00012169
Linear Formula: C2H12B10
Product Type: Chemical
| assay | 98% |
| InChI | 1S/C2H12B10/c1-2-4-6-8-10 |
| InChI key | PWHTZDUTEHXWHV-UPHRSURJSA |
| mp | 260 °C (subl.) (lit.) |
| SMILES string | [bH]1[bH][bH][bH][bH][bH] |
| storage temp. | 2-8°C |
| General description: | Electron deficient boron cage compounds with one or more carbon atoms as a ligand in the borane framework. The three common isomers are o-carborane, m-carborane and p-carborane 1The structure could be polyhedral or open cage. |
| Packaging: | 1 g in glass bottle |
| Packaging: | Packaged in glass bottles |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 |
| Precautionary statements | P261 - P264 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 260 °C (subl.) (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352300 |

