Dibutyltin diacetate
ALDRICH/290890 - technical grade
Synonym: Diacetoxydibutyltin
CAS Number: 1067-33-0
Empirical Formula (Hill Notation): C12H24O4Sn
Molecular Weight: 351.03
EC Number: 213-928-8
MDL Number: MFCD00008697
Linear Formula: (CH3CH2CH2CH2)2Sn(OCOCH3)2
Product Type: Chemical
| bp | 142-145 °C/10 mmHg (lit.) |
| density | 1.32 g/mL at 25 °C (lit.) |
| grade | technical grade |
| InChI | 1S/2C4H9.2C2H4O2.Sn/c2*1- |
| InChI key | JJLKTTCRRLHVGL-UHFFFAOYSA |
| mp | 7-10 °C (lit.) |
| refractive index | n |
| SMILES string | CCCC[Sn](CCCC)(OC(C)=O)OC |
| vapor density | 12 (vs air) |
| vapor pressure | 1.3 mmHg ( 25 °C) |
| Application: | Dibutyltin diacetate can be used as a catalyst to synthesize:• Wittenberger tetrazole derivatives by reacting with various nitriles in the presence of trimethylsilyl azide. • Carbamate derivatives from various isocyanates and alcohols in the presence of dichloromethane as solvent. • Urea derivatives from aryl isocyanates and various amines in the presence of 4-methylmorpholine. |
| General description: | Dibutyltin diacetate is an organotin compound that is commonly used as a catalyst in organic synthesis. |
| Packaging: | 50, 250 mL in glass bottle |
| Symbol |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H314 - H317 - H341 - H360 - H370 - H372 - H410 |
| Precautionary statements | P201 - P273 - P280 - P303 + P361 + P353 - P305 + P351 + P338 - P308 + P311 |
| Hazard Codes | T,C,N |
| Risk Statements | 60-61-34-43-48/25-50/53-68 |
| Safety Statements | 53-26-36/37/39-45-60-61 |
| RIDADR | UN2922 - class 8 - PG 2 - EHS - basic - Corrosive liquids, toxic |
| WGK Germany | WGK 3 |
| Flash Point(F) | 302.9 °F - Pensky-Martens c |
| Flash Point(C) | 150.5 °C - Pensky-Martens c |
| bp | 142-145 °C/10 mmHg (lit.) |
| mp | 7-10 °C (lit.) |
| Density | 1.32 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352103 |