1,4-Bis(trifluoromethyl)benzene
ALDRICH/290912 - 98%
Synonym: α,α,α,α′,α′,α′-Hexafluoro-p-xylene
CAS Number: 433-19-2
Empirical Formula (Hill Notation): C8H4F6
Molecular Weight: 214.11
EC Number: 207-086-0
MDL Number: MFCD00000402
Linear Formula: C6H4(CF3)2
Product Type: Chemical
| assay | 98% |
| bp | 116 °C (lit.) |
| density | 1.381 g/mL at 25 °C (lit.) |
| functional group | fluoro |
| InChI | 1S/C8H4F6/c9-7(10,11)5-1- |
| InChI key | PDCBZHHORLHNCZ-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | FC(F)(F)c1ccc(cc1)C(F)(F) |
| General description: | The infrared absorption of liquid 1,4-bis(trifluoromethyl) benzene has been studied using LiF, NaCl and KBr prisms. |
| Packaging: | 25 g in glass bottle |
| Symbol | ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H315 - H319 - H335 |
| Precautionary statements | P210 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 1993BF 3 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 71.6 °F - closed cup |
| Flash Point(C) | 22 °C - closed cup |
| Purity | 98% |
| bp | 116 °C (lit.) |
| Density | 1.381 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |



