1-Chloro-2-propanol
ALDRICH/292087 - 70%
Synonym: Chloropropanol; Propylene chlorohydrin
CAS Number: 127-00-4
Empirical Formula (Hill Notation): C3H7ClO
Molecular Weight: 94.54
EC Number: 204-819-6
MDL Number: MFCD00004530
Linear Formula: CH3CH(OH)CH2Cl+CH3CHClCH2OH
Product Type: Chemical
| assay | 70% |
| bp | 126-127 °C (lit.) |
| density | 1.111 g/mL at 25 °C (lit.) |
| functional group | chloro |
| hydroxyl | |
| impurities | <25% 2-chloro-1-propanol |
| InChI | 1S/C3H7ClO/c1-3(5)2-4/h3, |
| InChI key | YYTSGNJTASLUOY-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | CC(O)CCl |
| Application: | 1-Chloro-2-propanol has been used as: • chemical intermediate for the manufacture of propylene oxide, a starting material for production of polyurethane polyols and propylene glycol • as α,β-halohydrin standard during the enzymatic synthesis of α,β-halohydrins from gaseous alkenes |
| General description: | 1-Chloro-2-propanol is formed as an intermediate during the degradation of meso-bis-(1-chloro-2-propyl)ether by Rhodococcus sp. strain DTB. |
| Packaging: | 25 g in glass bottle |
| Symbol | ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H226 - H301 + H331 - H315 - H319 - H335 |
| Precautionary statements | P210 - P301 + P310 + P330 - P302 + P352 - P304 + P340 + P311 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 10-20-36/37/38 |
| Safety Statements | 26-36/39 |
| RIDADR | UN 2611 3(6.1) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 125.6 °F - closed cup |
| Flash Point(C) | 52 °C - closed cup |
| Purity | 70% |
| bp | 126-127 °C (lit.) |
| Density | 1.111 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |



