DL-Isoleucine
ALDRICH/298689 - ReagentPlus®, 99%
Synonym: DL-
CAS Number: 443-79-8
Empirical Formula (Hill Notation): C6H13NO2
Molecular Weight: 131.17
EC Number: 207-139-8
MDL Number: MFCD00004268
Linear Formula: CH3CH2CH(CH3)CH(NH2)COOH
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | 99% |
| InChI | 1S/C6H13NO2/c1-3-4(2)5(7) |
| InChI key | AGPKZVBTJJNPAG-RFZPGFLSSA |
| mp | 290 °C (dec.) (lit.) |
| product line | ReagentPlus® |
| reaction suitability | reaction type: solution phase peptide synthesis |
| SMILES string | CC[C@@H](C)[C@@H](N)C(O)= |
| Legal Information: | ReagentPlus is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | A mixture of stereoisomers. |
| Packaging: | 10, 50 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 290 °C (dec.) (lit.) |
| UNSPSC | 12352209 |