Palladium(II) trifluoroacetate
ALDRICH/299685 - 97%
Synonym: Pd(TFA)2; Trifluoroacetic acid palladium(II) salt
CAS Number: 42196-31-6
Empirical Formula (Hill Notation): C4F6O4Pd
Molecular Weight: 332.45
MDL Number: MFCD00013204
Linear Formula: (CF3COO)2Pd
Product Type: Chemical
Pd(OOCCF3)2
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 299685-1G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 299685-5G
| assay | 97% |
| form | solid |
| InChI | 1S/2C2HF3O2.Pd/c2*3-2(4,5 |
| InChI key | PBDBXAQKXCXZCJ-UHFFFAOYSA |
| mp | ~220 °C |
| reaction suitability | core: palladium |
| reaction type: Buchwald-Hartwig Cross Coupling Reaction | |
| reaction type: Cross Couplings | |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: catalyst reaction type: C-H Activation |
|
| SMILES string | FC(F)(F)C(=O)O[Pd]OC(=O)C |
| Application: | Application Guide for Palladium Catalyzed Cross-Coupling Reactions  |
| Application: | Catalyst used for the mild decarboxylation of electron-rich aromatic acids and the direct cross-coupling of unactivated arenes. |
| Application: | Catalyzes the selective allylic oxidation of geranylacetone and other olefins to their allyl acetates, which can then be converted to keto alcohols. |
| General description: | Palladium(II) trifluoroacetate is a catalyst used in Suzuki-Miyaura, Heck, and Stille cross-coupling reactions. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | ~220 °C |
| UNSPSC | 12161600 |