Methyl pentafluorobenzoate
ALDRICH/303070 - 99%
CAS Number: 36629-42-2
Empirical Formula (Hill Notation): C8H3F5O2
Molecular Weight: 226.10
MDL Number: MFCD00012172
Linear Formula: C6F5CO2CH3
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 303070-5G.
| assay | 99% |
| density | 1.532 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ester |
| fluoro | |
| InChI | 1S/C8H3F5O2/c1-15-8(14)2- |
| InChI key | UXJRQNXHCZKHRJ-UHFFFAOYSA |
| refractive index | n |
| SMILES string | COC(=O)c1c(F)c(F)c(F)c(F) |
| Application: | Methyl pentafluorobenzoate was used in preparation of photocoupling agent, based on perfluorophenylazide (PFPA)-conjugated polyallylamine, for efficient immobilization of polymers, nanoparticles, graphene and small molecules. It was also used in preparation of photoactive reagent N-hydroxysuccinimide (NHS)-PFPA. |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Flash Point(F) | 172.4 °F - closed cup |
| Flash Point(C) | 78 °C - closed cup |
| Purity | 99% |
| Density | 1.532 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |