Pentaethylene glycol di(p-toluenesulfonate)
ALDRICH/309583 - 95%
Synonym: 3,6,9,12-
CAS Number: 41024-91-3
Empirical Formula (Hill Notation): C24H34O10S2
Molecular Weight: 546.65
MDL Number: MFCD00012204
Linear Formula: CH3C6H4SO3(CH2CH2O)5SO2C6H4CH3
Product Type: Chemical
| assay | 95% |
| density | 1.26 g/mL at 25 °C (lit.) |
| form | viscous liquid |
| functional group | ether |
| tosylate | |
| InChI | 1S/C24H34O10S2/c1-21-3-7- |
| InChI key | BUHGDYPBQWWWQS-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | Cc1ccc(cc1)S(=O)(=O)OCCOC |
| Application: | Pentaethylene glycol di(p-toluenesulfonate) was used in the preparation of 3′-formylbenzo-18-crown-6 by undergoing coupling reaction with 2,3-dihydroxybenzaldehyde |
| Packaging: | 5, 25 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | 95% |
| Density | 1.26 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |


