2-Fluoro-4-(trifluoromethyl)benzoic acid
ALDRICH/310867 - 99%
CAS Number: 115029-24-8
Empirical Formula (Hill Notation): C8H4F4O2
Molecular Weight: 208.11
MDL Number: MFCD00010322
Linear Formula: FC6H3(CF3)CO2H
Product Type: Chemical
| assay | 99% |
| functional group | carboxylic acid |
| fluoro | |
| InChI | 1S/C8H4F4O2/c9-6-3-4(8(10 |
| InChI key | OCIYTBZXTFPSPI-UHFFFAOYSA |
| mp | 168-170 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | OC(=O)c1ccc(cc1F)C(F)(F)F |
| General description: | The molecular properties (both steric as well as electronic) of 2-fluoro-4-(trifluorometh |
| Packaging: | 5 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 168-170 °C (lit.) |
| UNSPSC | 12352100 |


