5-Hydroxyisophthalic acid
ALDRICH/311278 - 97%
CAS Number: 618-83-7
Empirical Formula (Hill Notation): C8H6O5
Molecular Weight: 182.13
EC Number: 210-565-7
MDL Number: MFCD00002515
Linear Formula: HOC6H3-1,3-(CO2H)2
Product Type: Chemical
| assay | 97% |
| InChI | 1S/C8H6O5/c9-6-2-4(7(10)1 |
| InChI key | QNVNLUSHGRBCLO-UHFFFAOYSA |
| mp | 298-302 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | OC(=O)c1cc(O)cc(c1)C(O)=O |
| General description: | The hydrothermal reaction of 5-hydroxyisophthalic acid, Co(II)/Cu(II) and dipyridophenazine, that forms two 3D chiral coordination polymers, was studied. |
| Packaging: | 100 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 298-302 °C (lit.) |
| UNSPSC | 12352100 |


