Diethylene glycol monobutyl ether
ALDRICH/32250 - ≥98.0% (GC)
Synonym: DEGBE; 2-
CAS Number: 112-34-5
Empirical Formula (Hill Notation): C8H18O3
Molecular Weight: 162.23
EC Number: 203-961-6
MDL Number: MFCD00002881
Linear Formula: CH3(CH2)3OCH2CH2OCH2CH2OH
Product Type: Chemical
| assay | ≥98.0% (GC) |
| bp | 224-228 °C (lit.) |
| density | 0.953 g/mL at 20 °C (lit.) |
| form | liquid |
| impurities | ≤0.05% water |
| InChI | 1S/C8H18O3/c1-2-3-5-10-7- |
| InChI key | OAYXUHPQHDHDDZ-UHFFFAOYSA |
| pH | 7 |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | CCCCOCCOCCO |
| technique(s) | GC/GC: suitable |
| Application: | Diethylene glycol monobutyl ether (DEGBE) is used: • In the preparation of blocked isocyanate systems for coil coating, electro-coating and powder coating. • As a cosurfactant in the formation of microemulsions. • As a structural component of various liquid crystals. |
| Packaging: | 1, 2.5 L in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264 - P280 - P305 + P351 + P338 - P337 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 24-26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 210.2 °F - closed cup |
| Flash Point(C) | 99 °C - closed cup |
| Purity | ≥98.0% (GC) |
| bp | 224-228 °C (lit.) |
| Density | 0.953 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |