1-Ethyl-4-(methoxycarbonyl)pyridinium iodide
ALDRICH/326259 - 97%
CAS Number: 1199-65-1
Empirical Formula (Hill Notation): C9H12INO2
Molecular Weight: 293.10
MDL Number: MFCD00011996
Linear Formula: C9H12INO2
Product Type: Chemical
| assay | 97% |
| functional group | ester |
| InChI | 1S/C9H12NO2.HI/c1-3-10-6- |
| InChI key | NGEAJXXGUZQCPN-UHFFFAOYSA |
| mp | 114-116 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | [I-].CC[n+]1ccc(cc1)C(=O) |
| Application: | 1-Ethyl-4-(methoxycarbony |
| General description: | Ion association/dissociation behavior of 1-ethyl-4-(methoxycarbony |
| Packaging: | 5 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 114-116 °C (lit.) |
| UNSPSC | 12352100 |


