(1R)-(+)-Nopinone
ALDRICH/327956 - 98%
Synonym: 6,6-
CAS Number: 38651-65-9
Empirical Formula (Hill Notation): C9H14O
Molecular Weight: 138.21
MDL Number: MFCD08447116
Linear Formula: C9H14O
Product Type: Chemical
| assay | 98% |
| bp | 209 °C (lit.) |
| density | 0.981 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C9H14O/c1-9(2)6-3-4-8( |
| InChI key | XZFDKWMYCUEKSS-BQBZGAKWSA |
| optical activity | [α]20/D +16°, neat |
| refractive index | n |
| SMILES string | CC1(C)[C@H]2CCC(=O)[C@@H] |
| storage temp. | 2-8°C |
| Application: | (1R)-(+)-Nopinone may be used in the preparation of a chiral annulated indene derivative, which can be a potentially useful chiral ligand for transition metal complexes in asymmetric transformations. It may also react with secondary amines in cyclohexane to form the corresponding enamines. |
| Packaging: | 1, 5 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 167.0 °F - closed cup |
| Flash Point(C) | 75 °C - closed cup |
| Purity | 98% |
| bp | 209 °C (lit.) |
| Density | 0.981 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352115 |