4,4′-Dibromobenzil
ALDRICH/328057 - 90%, technical grade
CAS Number: 35578-47-3
Empirical Formula (Hill Notation): C14H8Br2O2
Molecular Weight: 368.02
EC Number: 252-628-1
MDL Number: MFCD00000104
Linear Formula: BrC6H4COCOC6H4Br
Product Type: Chemical
| assay | 90% |
| functional group | bromo |
| ketone | |
| grade | technical grade |
| InChI | 1S/C14H8Br2O2/c15-11-5-1- |
| InChI key | NYCBYBDDECLFPE-UHFFFAOYSA |
| mp | 224-226 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | Brc1ccc(cc1)C(=O)C(=O)c2c |
| Application: | 4,4′-Dibromobenzil was used in preparation of 5,5′-bis -(4-bromo-phenyl)-3-methy |
| Packaging: | 10 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 90% |
| mp | 224-226 °C (lit.) |
| UNSPSC | 12352100 |


