1,2,3,3-Tetramethyl-3H-indolium iodide
ALDRICH/328979 - 98%
CAS Number: 5418-63-3
Empirical Formula (Hill Notation): C12H16IN
Molecular Weight: 301.17
EC Number: 226-526-2
MDL Number: MFCD00013333
Linear Formula: C12H16IN
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 328979-25G
| application(s) | diagnostic assay manufacturing hematology histology |
| assay | 98% |
| form | powder or crystals |
| InChI | 1S/C12H16N.HI/c1-9-12(2,3 |
| InChI key | HCYIOKVZAATOEW-UHFFFAOYSA |
| mp | 258 °C (dec.) (lit.) |
| SMILES string | [I-].CC1=[N+](C)c2ccccc2C |
| solubility | methanol: 25 mg/mL, clear |
| storage temp. | room temp |
| Packaging: | 5, 25 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H335 |
| Precautionary statements | P301 + P312 + P330 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 258 °C (dec.) (lit.) |
| Storage Temp. | room temp |
| UNSPSC | 12171500 |