1,5-Diamino-2-methylpentane
ALDRICH/329665 - 99%
Synonym: 2-
CAS Number: 15520-10-2
Empirical Formula (Hill Notation): C6H16N2
Molecular Weight: 116.20
EC Number: 239-556-6
MDL Number: MFCD00013460
Linear Formula: NH2CH2CH2CH2CH(CH3)CH2NH2
Product Type: Chemical
| assay | 99% |
| autoignition temp. | 568 °F |
| bp | 193 °C (lit.) |
| density | 0.86 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C6H16N2/c1-6(5-8)3-2-4 |
| InChI key | JZUHIOJYCPIVLQ-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | CC(CN)CCCN |
| vapor pressure | 130 mmHg ( 135 °C) |
| Application: | 1,5-Diamino-2-methylpenta • An activated amine for CO2 capture. This is attributed to its unique chemical structure, which allows for more effective interaction with CO₂ molecules, leading to higher capture efficiency. |
| General description: | 1,5-Diamino-2-methylpenta |
| Packaging: | 1, 2.5 L in glass bottle |
| Packaging: | 25 mL in glass bottle |
| Symbol | ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290 - H302 + H332 - H314 |
| Precautionary statements | P234 - P280 - P301 + P312 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735PSN2 8 / PGI |
| WGK Germany | WGK 3 |
| Flash Point(F) | 181.4 °F |
| Flash Point(C) | 83 °C |
| Purity | 99% |
| bp | 193 °C (lit.) |
| Density | 0.86 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |



