1,5-Diamino-2-methylpentane
ALDRICH/329665 - 99%
Synonym: 2-
CAS Number: 15520-10-2
Empirical Formula (Hill Notation): C6H16N2
Molecular Weight: 116.20
EC Number: 239-556-6
MDL Number: MFCD00013460
Linear Formula: NH2CH2CH2CH2CH(CH3)CH2NH2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 329665-1L.
| assay | 99% |
| autoignition temp. | 568 °F |
| bp | 193 °C (lit.) |
| density | 0.86 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C6H16N2/c1-6(5-8)3-2-4 |
| InChI key | JZUHIOJYCPIVLQ-UHFFFAOYSA |
| refractive index | n |
| SMILES string | CC(CN)CCCN |
| vapor pressure | 130 mmHg ( 135 °C) |
| Packaging: | 1, 2.5 L in glass bottle |
| Packaging: | 25 mL in glass bottle |
| Symbol |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H290 - H302 + H332 - H314 |
| Precautionary statements | P234 - P280 - P301 + P312 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735PSN2 8 / PGI |
| WGK Germany | WGK 3 |
| Flash Point(F) | 181.4 °F |
| Flash Point(C) | 83 °C |
| Purity | 99% |
| bp | 193 °C (lit.) |
| Density | 0.86 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |