(1R,2S)-(−)-2-Amino-1,2-diphenylethanol
ALDRICH/331899 - 99%
CAS Number: 23190-16-1
Empirical Formula (Hill Notation): C14H15NO
Molecular Weight: 213.28
MDL Number: MFCD00074960
Linear Formula: C6H5CH(NH2)CH(C6H5)OH
Product Type: Chemical
This picture is provided solely for illustration purposes, it may have been created or edited with AI. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 331899-1G
ATR-IR Spectra for (1R,2S)-(−)-2-Amino-1,2-diphenylethanol.
| assay | 99% |
| form | solid |
| functional group | amine |
| hydroxyl | |
| phenyl | |
| InChI | 1S/C14H15NO/c15-13(11-7-3 |
| InChI key | GEJJWYZZKKKSEV-UONOGXRCSA |
| mp | 142-144 °C (lit.) |
| optical activity | [α]25/D −7.0°, c = 0.6 in ethanol |
| SMILES string | N[C@H]([C@H](O)c1ccccc1)c |
| Application: | Chiral auxiliary used for Pd(II)-assisted chiral tandem alkylation and carbonylative coupling reactions. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 142-144 °C (lit.) |
| UNSPSC | 12352116 |