Synonym: (E )-4-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide; Pyridinium, 4-[2-[4-(dimethylamino)phenyl]ethenyl]-1-methyl-, iodide,
CAS Number: 68971-03-9
Empirical Formula (Hill Notation): C16H19IN2
Molecular Weight: 366.24
MDL Number: MFCD00031907
Linear Formula: C16H19IN2
Product Type: Chemical
| λmax |
475 nm |
| composition |
Dye content, 98% |
| InChI |
1S/C16H19N2.HI/c1-17(2)16-8-6-14(7-9-16)4-5-15-10-12-18(3)13-11-15;/h4-13H,1-3H3;1H/q+1;/p-1 |
| InChI key |
UJNFDSOJKNOBIA-UHFFFAOYSA-M |
| mp |
254-256 °C (lit.) |
| Quality Level |
100  |
| SMILES string |
[I-].[H]C(=C([H])c1cc[n+](C)cc1)c2ccc(cc2)N(C)C |
| Application: |
DASP can be used to characterize the fluorescence of zeolite crystals which can further be used in the development of photofunctional materials. |
| General description: |
trans-4-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide (DASP) is a hemicyanine dye that can be used as a fluorescence probe. Its fluorescent property can be tuned by adjusting the pH of the solution. It can be photoexcited for internal twisting that forms intermolecular charge transfer state. |
| General description: |
trans-4-[4-(dimethylamino)-styryl]-1-methylpyridinium iodide (DASPI) is a hemicyanine dye. |
| Packaging: |
1 g in glass bottle |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26-37/39 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| mp |
254-256 °C (lit.) |
| UNSPSC |
12352103 |
