Dibenzyl N,N-dimethylphosphoramidite
ALDRICH/33737
CAS Number: 164654-49-3
Empirical Formula (Hill Notation): C16H20NO2P
Molecular Weight: 289.31
MDL Number: MFCD00239442
Linear Formula: C16H20NO2P
Product Type: Chemical
| density | 1.089 g/mL at 20 °C (lit.) |
| functional group | amine |
| phenyl | |
| InChI | 1S/C16H20NO2P/c1-17(2)20( |
| InChI key | GDEJGFHRPXLQNN-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| refractive index | n |
| SMILES string | CN(C)P(OCc1ccccc1)OCc2ccc |
| storage temp. | 2-8°C |
| Application: | Dibenzyl N,N-dimethylphosphoramidite was used in the preparation of dibenzyl phosphoramidates incorporating the representative C-terminal protected amino acids leucine, phenylalanine, glutamic acid and proline. It was also used for the fast and clean phosphitylation of alcohols, including hindered alcohols. |
| Packaging: | 5 mL in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.089 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352100 |


