Synonym: (3R,4S,5R)-3,4,6-Tri-O-benzyl-D-glucal; 1,5-Anhydro-2-deoxy-3,4,6-tris-O-(phenylmethyl)-D-arabino-hex-1-enitol; 3,4,6-Tri-O-benzyl-D-glucal; Tri-OBn-glucal
CAS Number: 55628-54-1
Empirical Formula (Hill Notation): C27H28O4
Molecular Weight: 416.51
MDL Number: MFCD00061640
Linear Formula: C27H28O4
Product Type: Chemical
| assay |
97% |
| InChI |
1S/C27H28O4/c1-4-10-22(11-5-1)18-28-21-26-27(31-20-24-14-8-3-9-15-24)25(16-17-29-26)30-19-23-12-6-2-7-13-23/h1-17,25-27H,18-21H2/t25-,26-,27+/m1/s1 |
| InChI key |
MXYLLYBWXIUMIT-PFBJBMPXSA-N |
| mp |
57-58 °C (lit.) |
| optical activity |
[α]25/D −2.7°, c = 5 in chloroform |
| Quality Level |
200  |
| SMILES string |
C(OCc1ccccc1)[C@H]2OC=C[C@@H](OCc3ccccc3)[C@@H]2OCc4ccccc4 |
| storage temp. |
−20°C |
| Application: |
Important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
97% |
| mp |
57-58 °C (lit.) |
| Storage Temp. |
−20°C |
| UNSPSC |
12352201 |
