Synonym: 4′-(Hexyloxy)-4-biphenyl-carbonitrile; 4′-(Hexyloxy)[1,1′-biphenyl]-4-carbonitrile; 4′-Hexyloxy-4-cyanobiphenyl; 4′-Hexyloxybiphenylyl-4-carbonitrile; 4-(4-Hexyloxyphenyl)benzonitrile; 4-(n-Hexyloxy)-4′-cyanobiphenyl; 4-Cyano-4′-(hexyloxy)biphenyl; 4-Cyano-4′-n -hexyloxybiphenyl; 4-Hexyloxy-4′-cyanobiphenyl; p -Hexyloxy-p ′-cyanobiphenyl
CAS Number: 41424-11-7
Empirical Formula (Hill Notation): C19H21NO
Molecular Weight: 279.38
EC Number: 255-358-2
MDL Number: MFCD00134145
Linear Formula: CH3(CH2)5OC6H4C6H4CN
Product Type: Chemical
| assay |
96% |
| form |
liquid crystal (nematic) |
| InChI |
1S/C19H21NO/c1-2-3-4-5-14-21-19-12-10-18(11-13-19)17-8-6-16(15-20)7-9-17/h6-13H,2-5,14H2,1H3 |
| InChI key |
YUYXUPYNSOFWFV-UHFFFAOYSA-N |
| mp |
56-58 °C (lit.) |
| SMILES string |
CCCCCCOc1ccc(cc1)-c2ccc(cc2)C#N |
| transition temp |
crystalline phase to nematic phase 56 °C |
| |
nematic phase to isotropic phase 76 °C |
| Application: |
Used to synthesize pH responsive block copolymers, binary mixtures. |
| General description: |
Also known as 6OCBs,these liquid crystals (LCs) are responsive to small changes in temperature, shear, electric (or magnetic) fields, and the structure of solid surfaces with which they are in contact. In LCs exhibiting smectic phases, such as these, the molecules show a degree of translational order and tend to align themselves in layers. |
| Packaging: |
1 g in glass bottle |
| Hazard statements |
H413 |
| Precautionary statements |
P273 |
| Hazard Codes |
Xn |
| Risk Statements |
20/21/22-36/37/38 |
| Safety Statements |
26-36 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
228.2 °F |
| Flash Point(C) |
109 °C |
| Purity |
96% |
| mp |
56-58 °C (lit.) |
| UNSPSC |
12352103 |
