(Bicyclo[2.2.1]hepta-2,5-diene)[1,4-bis(diphenylphosphino)butane]rhodium(I) tetrafluoroborate
ALDRICH/341126
CAS Number: 82499-43-2
Empirical Formula (Hill Notation): C35H36BF4P2Rh
Molecular Weight: 708.32
MDL Number: MFCD00075218
Linear Formula: C35H36BF4P2Rh
Product Type: Chemical
| InChI | 1S/C28H28P2.C7H8.BF4.Rh/c |
| InChI key | FVKIJNAEINIHMG-UHFFFAOYSA |
| mp | 210 °C (dec.) (lit.) |
| Quality Level | 200 ![]() |
| reaction suitability | core: rhodium |
| reagent type: catalyst | |
| SMILES string | [Rh+].F[B-](F)(F)F.C1C2C= |
| Other Notes: | Contains up to 1 mole acetone of crystallization |
| Packaging: | 100 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H315 - H319 - H335 |
| Precautionary statements | P261 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 210 °C (dec.) (lit.) |
| UNSPSC | 12161600 |


