[1,4-Bis(diphenylphosphino)butane](1,5-cyclooctadiene)rhodium(I) tetrafluoroborate
ALDRICH/341134 - 98%
Synonym: [Rh(dppb)(COD)]BF4
CAS Number: 79255-71-3
Empirical Formula (Hill Notation): C36H40BF4P2Rh
Molecular Weight: 724.36
MDL Number: MFCD00075219
Linear Formula: C36H40BF4P2Rh
Product Type: Chemical
| assay | 98% |
| InChI | 1S/C28H28P2.C8H12.BF4.Rh/ |
| InChI key | YESRLRPURJQQBI-ONEVTFJLSA |
| mp | 205 °C (dec.) (lit.) |
| Quality Level | 100 ![]() |
| reaction suitability | core: rhodium |
| reagent type: catalyst | |
| SMILES string | [Rh+].F[B-](F)(F)F.C1CC=C |
| Application: | [1,4-Bis(diphenylphosphin • Enantioselective reductive amination of α-ketoacids with benzylamines to synthesize α-N-benzylamino acids. • Stereoselective hydrogenation of α-(hydroxymethyl)-acrylate derivatives to synthesize 3-hydroxy-2-methylpropano |
| General description: | [1,4-Bis(diphenylphosphin |
| Packaging: | 100, 500 mg in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H315 - H319 - H335 |
| Precautionary statements | P261 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 205 °C (dec.) (lit.) |
| UNSPSC | 12161600 |


