Synonym: 1,1-Cyclopropanedicarboxylic acid cyclic isopropylidene ester; 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione
CAS Number: 5617-70-9
Empirical Formula (Hill Notation): C8H10O4
Molecular Weight: 170.16
EC Number: 227-044-5
MDL Number: MFCD00042796
Linear Formula: C8H10O4
Product Type: Chemical
This picture is provided solely for illustration purposes, it may have been created or edited with AI. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 341266-5G
ATR-IR Spectra for 1,1-Cyclopropanedicarboxylic acid cyclic isopropylidene ester.
| assay |
99% |
| functional group |
ester |
| |
ketal |
| InChI |
1S/C8H10O4/c1-7(2)11-5(9)8(3-4-8)6(10)12-7/h3-4H2,1-2H3 |
| InChI key |
AXJVPXNVESYGDT-UHFFFAOYSA-N |
| mp |
63-65 °C (lit.) |
| Quality Level |
100  |
| SMILES string |
CC1(C)OC(=O)C2(CC2)C(=O)O1 |
| solubility |
diethyl ether: soluble(lit.) |
| |
DMF: soluble(lit.) |
| |
THF: soluble |
| |
water: insoluble(lit.) |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
99% |
| mp |
63-65 °C (lit.) |
| UNSPSC |
12352100 |