Trioctylphosphine oxide
ALDRICH/346187 - technical grade, 90%
Synonym: (Oct)3PO; TOPO®
CAS Number: 78-50-2
Empirical Formula (Hill Notation): C24H51OP
Molecular Weight: 386.63
EC Number: 201-121-3
MDL Number: MFCD00002083
Linear Formula: [CH3(CH2)7]3PO
Product Type: Chemical
| assay | 90% |
| bp | 201-202 °C/2 mmHg (lit.) |
| form | solid |
| functional group | phosphine oxide |
| grade | technical grade |
| InChI | 1S/C24H51OP/c1-4-7-10-13- |
| InChI key | ZMBHCYHQLYEYDV-UHFFFAOYSA |
| mp | 50-52 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | CCCCCCCCP(=O)(CCCCCCCC)CC |
| Application: | Used as an extraction or stabilizing agent; also useful as a capping ligand for the production of quantum dots such as CdSe. |
| Legal Information: | TOPO is a registered trademark of Life Technologies |
| Packaging: | 100, 500 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H315 - H318 |
| Precautionary statements | P280 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-41 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | 90% |
| bp | 201-202 °C/2 mmHg (lit.) |
| mp | 50-52 °C (lit.) |
| UNSPSC | 12352119 |


