Z-Phe-OH
ALDRICH/359807 - 99%
Synonym: N-(Carbobenzyloxy)-L-phenylalanine; Z-L-Phenylalanine
CAS Number: 1161-13-3
Empirical Formula (Hill Notation): C17H17NO4
Molecular Weight: 299.32
EC Number: 214-599-3
MDL Number: MFCD00020418
Linear Formula: C6H5CH2CH(NHCOOCH2C6H5)COOH
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | 99% |
| InChI | 1S/C17H17NO4/c19-16(20)15 |
| InChI key | RRONHWAVOYADJL-HNNXBMFYSA |
| mp | 85-87 °C (lit.) |
| optical activity | [α]20/D +5°, c = 5 in acetic acid |
| Quality Level | 200 ![]() |
| reaction suitability | reaction type: solution phase peptide synthesis |
| SMILES string | OC(=O)[C@H](Cc1ccccc1)NC( |
| Biochem/physiol Actions: | Inhibitor of thermolysin |
| Packaging: | 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 85-87 °C (lit.) |
| UNSPSC | 12352209 |

