3-Isopropenyl-α,α-dimethylbenzyl isocyanate
ALDRICH/361771 - 95%, contains ≤200 ppm BHT as inhibitor
Synonym: 3-Isopropenyl-α,α′-dimethylbenzyl isocyanate; m -Isoprenyl-α,α′-dimethylbenzyl isocyanate
CAS Number: 2094-99-7
Empirical Formula (Hill Notation): C13H15NO
Molecular Weight: 201.26
EC Number: 402-440-2
MDL Number: MFCD00080490
Linear Formula: H2C=C(CH3)C6H4C(CH3)2NCO
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 361771-1L.
| assay | 95% |
| autoignition temp. | 838 °F |
| bp | 268-271 °C (lit.) |
| contains | ≤200 ppm BHT as inhibitor |
| density | 1.018 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C13H15NO/c1-10(2)11-6- |
| InChI key | ZVEMLYIXBCTVOF-UHFFFAOYSA |
| refractive index | n |
| SMILES string | CC(=C)c1cccc(c1)C(C)(C)N= |
| Application: | m-TMI can be used as a tetrafunctional isocyanate which can further be used in the development of polymer electrolyte. It can be used as a coupling agent in the preparation of jute reinforced polypropylene. |
| General description: | 3-Isopropenyl-α,α-dimethy |
| Packaging: | 1 L in glass bottle |
| Packaging: | 250 mL in glass bottle |
| Symbol |     GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H314 - H317 - H330 - H334 - H373 - H410 |
| Precautionary statements | P273 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 + P310 |
| Hazard Codes | T+,N |
| Risk Statements | 26-34-42/43-48/20-50/53 |
| Safety Statements | 7-15-28-36/37/39-38-45-60-61 |
| RIDADR | UN 2206PSN1B 6.1 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| bp | 268-271 °C (lit.) |
| Density | 1.018 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12162002 |