Synonym: α-Narcotine; (3S)-6,7-Dimethoxy-3-[(5R)-5,6,7,8-tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-1(3H)-isobenzofuranone
CAS Number: 128-62-1
Empirical Formula (Hill Notation): C22H23NO7
Molecular Weight: 413.42
EC Number: 204-899-2
MDL Number: MFCD00069316
Linear Formula: C22H23NO7
Product Type: Chemical
| assay |
97% |
| form |
solid |
| InChI |
1S/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3/t17-,18+/m1/s1 |
| InChI key |
AKNNEGZIBPJZJG-MSOLQXFVSA-N |
| mp |
174-176 °C (lit.) |
| optical activity |
[α]20/D −200°, c = 1 in chloroform |
| SMILES string |
COc1ccc2C(OC(=O)c2c1OC)C3N(C)CCc4cc5OCOc5c(OC)c34 |
| Application: |
Noscapine may be used as a source to synthesize its bromo-derivatives, which has higher tubulin binding activity when compared to noscapine. Its 3,4,5-trimethoxybenzyl analog is a potential antitumor agent. |
| General description: |
(S,R)-Noscapine is a phthalideisoquinoline alkaloid found in opium. It is an antimicrotubule agent that also shows potent antitumor activity. |
| Packaging: |
5 g in glass bottle |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 - H336 |
| Precautionary statements |
P301 + P312 + P330 |
| Hazard Codes |
Xn |
| Risk Statements |
22 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
97% |
| mp |
174-176 °C (lit.) |
| UNSPSC |
12352005 |
