Synonym: 2,2′-Bipyridinepalladium dichloride; 2,2′-Bipyridylpalladium dichloride; Bis(2,2′-Bipyridine)palladium dichloride; Dichloro(2,2′-bipyridine)palladium
CAS Number: 14871-92-2
Empirical Formula (Hill Notation): C10H8Cl2N2Pd
Molecular Weight: 333.51
MDL Number: MFCD00134305
Linear Formula: C10H8Cl2N2Pd
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 365947-1G
| InChI |
1S/C10H8N2.2ClH.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChI key |
MUNARLQNCCGPQU-UHFFFAOYSA-L |
| Quality Level |
200  |
| reaction suitability |
core: palladium |
| |
reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| |
reaction type: Cross Couplings |
| |
reaction type: Heck Reaction |
| |
reaction type: Hiyama Coupling |
| |
reaction type: Negishi Coupling |
| |
reaction type: Sonogashira Coupling |
| |
reaction type: Stille Coupling |
| |
reaction type: Suzuki-Miyaura Coupling |
| |
reagent type: catalyst |
| SMILES string |
Cl[Pd]Cl.c1ccc(nc1)-c2ccccn2 |
| Packaging: |
1 g in glass bottle |