4-Methyl-2-nitroanisole
ALDRICH/367699 - 99%
CAS Number: 119-10-8
Empirical Formula (Hill Notation): C8H9NO3
Molecular Weight: 167.16
EC Number: 204-296-4
MDL Number: MFCD00024540
Linear Formula: CH3C6H3(NO2)OCH3
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 367699-100ML.
| assay | 99% |
| bp | 154 °C/14 mmHg (lit.) |
| density | 1.205 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | nitro |
| InChI | 1S/C8H9NO3/c1-6-3-4-8(12- |
| InChI key | LGNMURXRPLMVJI-UHFFFAOYSA |
| mp | 8-9 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | COc1ccc(C)cc1[N+]([O-])=O |
| Application: | 4-Methyl-2-nitroanisole may be used in the synthesis of 1-dibromomethyl-4-methoxy |
| General description: | Nucleophilic substitution reactions of 4-methyl-2-nitroanisole in neat cyclohexylamine and piperidine have been reported. |
| Packaging: | 100 mL in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264 - P270 - P301 + P312 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | 99% |
| bp | 154 °C/14 mmHg (lit.) |
| mp | 8-9 °C (lit.) |
| Density | 1.205 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |