Triacetoxy(methyl)silane
ALDRICH/372358 - technical grade, 90%
Synonym: Methyltriacetoxysilane
CAS Number: 4253-34-3
Empirical Formula (Hill Notation): C7H12O6Si
Molecular Weight: 220.25
EC Number: 224-221-9
MDL Number: MFCD00008694
Linear Formula: (CH3CO2)3SiCH3
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 372358-100G
| assay | 90% |
| bp | 94-95 °C/9 mmHg (lit.) |
| density | 1.20 g/mL at 20 °C (lit.) |
| form | solid |
| grade | technical grade |
| InChI | 1S/C7H12O6Si/c1-5(8)11-14 |
| InChI key | TVJPBVNWVPUZBM-UHFFFAOYSA |
| mp | 40-45 °C (lit.) |
| SMILES string | CC(=O)O[Si](C)(OC(C)=O)OC |
| Packaging: | 100 g in glass bottle |
| Symbol |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302 - H314 |
| Precautionary statements | P260 - P280 - P301 + P312 + P330 - P301 + P330 + P331 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1759 8 / PGII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 183.2 °F - closed cup |
| Flash Point(C) | 84 °C - closed cup |
| Purity | 90% |
| bp | 94-95 °C/9 mmHg (lit.) |
| mp | 40-45 °C (lit.) |
| Density | 1.20 g/mL at 20 °C (lit.) |
| UNSPSC | 12352100 |