(R)-2,5-Dihydro-3,6-dimethoxy-2-isopropylpyrazine
ALDRICH/37286 - ≥97.0% (GC)
Synonym: (R)-Schollkopf Reagent; (R)
CAS Number: 109838-85-9
Empirical Formula (Hill Notation): C9H16N2O2
Molecular Weight: 184.24
MDL Number: MFCD00040565
Linear Formula: C9H16N2O2
Product Type: Chemical
| assay | ≥97.0% (GC) |
| density | 1.028 g/mL at 20 °C (lit.) |
| form | liquid |
| InChI | 1S/C9H16N2O2/c1-6(2)8-9(1 |
| InChI key | FCFWEOGTZZPCTO-MRVPVSSYSA |
| optical activity | [α]20/D −102±5°, c = 1% in ethanol |
| Quality Level | 100 ![]() |
| SMILES string | COC1=N[C@H](C(C)C)C(OC)=N |
| Application: | (R)-2,5-Dihydro-3,6-dimetho |
| Other Notes: | Chiral auxiliary for the synthesis of α-amino acids |
| Packaging: | 1, 5 mL in glass bottle |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 185.0 °F - closed cup |
| Flash Point(C) | 85.0 °C - closed cup |
| Purity | ≥97.0% (GC) |
| Density | 1.028 g/mL at 20 °C (lit.) |
| UNSPSC | 12352005 |

