3-Nitrophenylacetonitrile
ALDRICH/377937 - 99%
CAS Number: 621-50-1
Empirical Formula (Hill Notation): C8H6N2O2
Molecular Weight: 162.15
EC Number: 210-689-1
MDL Number: MFCD00041249
Linear Formula: O2NC6H4CH2CN
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 377937-5G
| assay | 99% |
| bp | 180 °C/3 mmHg (lit.) |
| InChI | 1S/C8H6N2O2/c9-5-4-7-2-1- |
| InChI key | WAVKEPUFQMUGBP-UHFFFAOYSA |
| mp | 60-62 °C (lit.) |
| SMILES string | [O-][N+](=O)c1cccc(CC#N)c |
| General description: | 3-Nitrophenylacetonitrile is a builing block. Reactions of 3-nitrophenylacetonitrile with isopropyl alcohol, cyclohexyl alcohol and benzyl alcohol at high temperature have been reported. |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 |
| Precautionary statements | P261 - P264 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| bp | 180 °C/3 mmHg (lit.) |
| mp | 60-62 °C (lit.) |
| UNSPSC | 12352100 |