Tri(2-furyl)phosphine
ALDRICH/383767 - 99%
Synonym: TFP; Tri-
CAS Number: 5518-52-5
Empirical Formula (Hill Notation): C12H9O3P
Molecular Weight: 232.17
MDL Number: MFCD00151857
Linear Formula: C12H9O3P
Product Type: Chemical
This picture is provided solely for illustration purposes, it may have been created or edited with AI. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 383767-1G
| assay | 99% |
| bp | 136 °C/4 mmHg (lit.) |
| form | solid |
| functional group | phosphine |
| InChI | 1S/C12H9O3P/c1-4-10(13-7- |
| InChI key | DLQYXUGCCKQSRJ-UHFFFAOYSA |
| mp | 59-64 °C (lit.) |
| Quality Level | 100  |
| reaction suitability | reagent type: ligand reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reagent type: ligand reaction type: Cycloisomerizations |
|
| reagent type: ligand reaction type: Heck Reaction |
|
| reagent type: ligand reaction type: Negishi Coupling |
|
| reagent type: ligand reaction type: Oxidations |
|
| reagent type: ligand reaction type: Sonogashira Coupling |
|
| reagent type: ligand reaction type: Stille Coupling |
|
| reagent type: ligand reaction type: Suzuki-Miyaura Coupling |
|
| SMILES string | c1coc(c1)P(c2ccco2)c3ccco |
| Packaging: | 1 g in glass bottle |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| bp | 136 °C/4 mmHg (lit.) |
| mp | 59-64 °C (lit.) |
| UNSPSC | 12352005 |