Synonym: (αR,4S)-2,2-Dimethyl-α-hydroxy-1,3-dioxolane-4-acetic acid methyl ester; 3,4-O-Isopropylidene-L-threonic acid methyl ester
CAS Number: 92973-40-5
Empirical Formula (Hill Notation): C8H14O5
Molecular Weight: 190.19
Linear Formula: C8H14O5
Product Type: Chemical
| assay |
97% |
| bp |
125 °C/12 mmHg (lit.) |
| density |
1.175 g/mL at 25 °C (lit.) |
| form |
liquid |
| InChI |
1S/C8H14O5/c1-8(2)12-4-5(13-8)6(9)7(10)11-3/h5-6,9H,4H2,1-3H3/t5-,6+/m0/s1 |
| InChI key |
JSFASCPVVJBLRD-NTSWFWBYSA-N |
| optical activity |
[α]20/D +18.5°, c = 2 in acetone |
| refractive index |
n20/D 1.446 (lit.) |
| SMILES string |
COC(=O)[C@H](O)[C@@H]1COC(C)(C)O1 |
| Application: |
Used to prepare a dihydrofuran substrate in the total synthesis of (-)-echinosporin. |
| Packaging: |
5 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
210.2 °F - closed cup |
| Flash Point(C) |
99 °C - closed cup |
| Purity |
97% |
| bp |
125 °C/12 mmHg (lit.) |
| Density |
1.175 g/mL at 25 °C (lit.) |
| Refractive Index |
n20/D 1.446 (lit.) |
| UNSPSC |
12352201 |
